C22H27ClN2O2 — CID 51310542
3-acetamido-N-(3-chloro-2,6-diethylphenyl)-3-(4-methylphenyl)propanamide (PubChem CID 51310542) has the molecular formula C22H27ClN2O2 and a molecular weight of 386.92 g/mol. Its IUPAC name is 3-acetamido-N-(3-chloro-2,6-diethylphenyl)-3-(4-methylphenyl)propanamide.
| Compound Name | 3-acetamido-N-(3-chloro-2,6-diethylphenyl)-3-(4-methylphenyl)propanamide |
|---|---|
| PubChem CID | 51310542 |
| Molecular Formula | C22H27ClN2O2 |
| Molecular Weight | 386.92 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 3-acetamido-N-(3-chloro-2,6-diethylphenyl)-3-(4-methylphenyl)propanamide |
| SMILES | CCc1ccc(Cl)c(CC)c1NC(=O)CC(NC(C)=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H27ClN2O2/c1-5-16-11-12-19(23)18(6-2)22(16)25-21(27)13-20(24-15(4)26)17-9-7-14(3)8-10-17/h7-12,20H,5-6,13H2,1-4H3,(H,24,26)(H,25,27) |
| InChIKey | AFRUIOAMOWAZFR-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.92 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |