C15H23ClN2O3 — CID 95771319
1-(3-chloro-2,6-diethylphenyl)-3-[(2S)-2-hydroxy-3-methoxypropyl]urea (PubChem CID 95771319) has the molecular formula C15H23ClN2O3 and a molecular weight of 314.81 g/mol. Its IUPAC name is 1-(3-chloro-2,6-diethylphenyl)-3-[(2S)-2-hydroxy-3-methoxypropyl]urea.
| Compound Name | 1-(3-chloro-2,6-diethylphenyl)-3-[(2S)-2-hydroxy-3-methoxypropyl]urea |
|---|---|
| PubChem CID | 95771319 |
| Molecular Formula | C15H23ClN2O3 |
| Molecular Weight | 314.81 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 1-(3-chloro-2,6-diethylphenyl)-3-[(2S)-2-hydroxy-3-methoxypropyl]urea |
| SMILES | CCc1ccc(Cl)c(CC)c1NC(=O)NC[C@H](O)COC |
| InChI | InChI=1S/C15H23ClN2O3/c1-4-10-6-7-13(16)12(5-2)14(10)18-15(20)17-8-11(19)9-21-3/h6-7,11,19H,4-5,8-9H2,1-3H3,(H2,17,18,20)/t11-/m0/s1 |
| InChIKey | RBKNTLKEFUPMQN-NSHDSACASA-N |
| XLogP | 2.59 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.81 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |