C11H14BrClN2O3 — CID 97054292
1-(3-bromo-4-chlorophenyl)-3-[(2S)-2-hydroxy-3-methoxypropyl]urea (PubChem CID 97054292) has the molecular formula C11H14BrClN2O3 and a molecular weight of 337.60 g/mol. Its IUPAC name is 1-(3-bromo-4-chlorophenyl)-3-[(2S)-2-hydroxy-3-methoxypropyl]urea.
| Compound Name | 1-(3-bromo-4-chlorophenyl)-3-[(2S)-2-hydroxy-3-methoxypropyl]urea |
|---|---|
| PubChem CID | 97054292 |
| Molecular Formula | C11H14BrClN2O3 |
| Molecular Weight | 337.60 g/mol |
| Exact Mass | 335.99 |
| IUPAC Name | 1-(3-bromo-4-chlorophenyl)-3-[(2S)-2-hydroxy-3-methoxypropyl]urea |
| SMILES | COC[C@@H](O)CNC(=O)Nc1ccc(Cl)c(Br)c1 |
| InChI | InChI=1S/C11H14BrClN2O3/c1-18-6-8(16)5-14-11(17)15-7-2-3-10(13)9(12)4-7/h2-4,8,16H,5-6H2,1H3,(H2,14,15,17)/t8-/m0/s1 |
| InChIKey | KTJOKGHNLSXVKJ-QMMMGPOBSA-N |
| XLogP | 2.23 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.60 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |