C12H16BrClN2O2 — CID 97320276
1-(3-bromo-4-chlorophenyl)-3-[(2R)-4-hydroxy-2-methylbutyl]urea (PubChem CID 97320276) has the molecular formula C12H16BrClN2O2 and a molecular weight of 335.63 g/mol. Its IUPAC name is 1-(3-bromo-4-chlorophenyl)-3-[(2R)-4-hydroxy-2-methylbutyl]urea.
| Compound Name | 1-(3-bromo-4-chlorophenyl)-3-[(2R)-4-hydroxy-2-methylbutyl]urea |
|---|---|
| PubChem CID | 97320276 |
| Molecular Formula | C12H16BrClN2O2 |
| Molecular Weight | 335.63 g/mol |
| Exact Mass | 334.01 |
| IUPAC Name | 1-(3-bromo-4-chlorophenyl)-3-[(2R)-4-hydroxy-2-methylbutyl]urea |
| SMILES | C[C@H](CCO)CNC(=O)Nc1ccc(Cl)c(Br)c1 |
| InChI | InChI=1S/C12H16BrClN2O2/c1-8(4-5-17)7-15-12(18)16-9-2-3-11(14)10(13)6-9/h2-3,6,8,17H,4-5,7H2,1H3,(H2,15,16,18)/t8-/m1/s1 |
| InChIKey | HBTFZGXBCQUPGZ-MRVPVSSYSA-N |
| XLogP | 3.24 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.63 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |