C15H21N3O2 — CID 111474667
1-(4-hydroxy-2-methylbutyl)-3-(2-methyl-1H-indol-5-yl)urea (PubChem CID 111474667) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is 1-(4-hydroxy-2-methylbutyl)-3-(2-methyl-1H-indol-5-yl)urea.
| Compound Name | 1-(4-hydroxy-2-methylbutyl)-3-(2-methyl-1H-indol-5-yl)urea |
|---|---|
| PubChem CID | 111474667 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 1-(4-hydroxy-2-methylbutyl)-3-(2-methyl-1H-indol-5-yl)urea |
| SMILES | Cc1cc2cc(NC(=O)NCC(C)CCO)ccc2[nH]1 |
| InChI | InChI=1S/C15H21N3O2/c1-10(5-6-19)9-16-15(20)18-13-3-4-14-12(8-13)7-11(2)17-14/h3-4,7-8,10,17,19H,5-6,9H2,1-2H3,(H2,16,18,20) |
| InChIKey | BXSVJJJFQYWRFT-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |