C13H18F2N2O3 — CID 111473727
1-[3-(difluoromethoxy)phenyl]-3-(4-hydroxy-2-methylbutyl)urea (PubChem CID 111473727) has the molecular formula C13H18F2N2O3 and a molecular weight of 288.29 g/mol. Its IUPAC name is 1-[3-(difluoromethoxy)phenyl]-3-(4-hydroxy-2-methylbutyl)urea.
| Compound Name | 1-[3-(difluoromethoxy)phenyl]-3-(4-hydroxy-2-methylbutyl)urea |
|---|---|
| PubChem CID | 111473727 |
| Molecular Formula | C13H18F2N2O3 |
| Molecular Weight | 288.29 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 1-[3-(difluoromethoxy)phenyl]-3-(4-hydroxy-2-methylbutyl)urea |
| SMILES | CC(CCO)CNC(=O)Nc1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C13H18F2N2O3/c1-9(5-6-18)8-16-13(19)17-10-3-2-4-11(7-10)20-12(14)15/h2-4,7,9,12,18H,5-6,8H2,1H3,(H2,16,17,19) |
| InChIKey | DEZNUHDVIMXHRS-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.29 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |