C20H19N3O3 — CID 111798539
N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-N'-(1-methylindol-6-yl)oxamide (PubChem CID 111798539) has the molecular formula C20H19N3O3 and a molecular weight of 349.39 g/mol. Its IUPAC name is N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-N'-(1-methylindol-6-yl)oxamide.
| Compound Name | N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-N'-(1-methylindol-6-yl)oxamide |
|---|---|
| PubChem CID | 111798539 |
| Molecular Formula | C20H19N3O3 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-N'-(1-methylindol-6-yl)oxamide |
| SMILES | Cn1ccc2ccc(NC(=O)C(=O)N[C@H]3c4ccccc4C[C@H]3O)cc21 |
| InChI | InChI=1S/C20H19N3O3/c1-23-9-8-12-6-7-14(11-16(12)23)21-19(25)20(26)22-18-15-5-3-2-4-13(15)10-17(18)24/h2-9,11,17-18,24H,10H2,1H3,(H,21,25)(H,22,26)/t17-,18+/m1/s1 |
| InChIKey | VCANKSMVMJRWTR-MSOLQXFVSA-N |
| XLogP | 1.89 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|