C18H17ClN2O3 — CID 111798362
N'-(4-chloro-2-methylphenyl)-N-(2-hydroxy-2,3-dihydro-1H-inden-1-yl)oxamide (PubChem CID 111798362) has the molecular formula C18H17ClN2O3 and a molecular weight of 344.80 g/mol. Its IUPAC name is N'-(4-chloro-2-methylphenyl)-N-(2-hydroxy-2,3-dihydro-1H-inden-1-yl)oxamide.
| Compound Name | N'-(4-chloro-2-methylphenyl)-N-(2-hydroxy-2,3-dihydro-1H-inden-1-yl)oxamide |
|---|---|
| PubChem CID | 111798362 |
| Molecular Formula | C18H17ClN2O3 |
| Molecular Weight | 344.80 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | N'-(4-chloro-2-methylphenyl)-N-(2-hydroxy-2,3-dihydro-1H-inden-1-yl)oxamide |
| SMILES | Cc1cc(Cl)ccc1NC(=O)C(=O)NC1c2ccccc2CC1O |
| InChI | InChI=1S/C18H17ClN2O3/c1-10-8-12(19)6-7-14(10)20-17(23)18(24)21-16-13-5-3-2-4-11(13)9-15(16)22/h2-8,15-16,22H,9H2,1H3,(H,20,23)(H,21,24) |
| InChIKey | PQORPBRERIQZLR-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.80 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|