C21H22N2O3 — CID 71861885
N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-N'-(5,6,7,8-tetrahydronaphthalen-1-yl)oxamide (PubChem CID 71861885) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-N'-(5,6,7,8-tetrahydronaphthalen-1-yl)oxamide.
| Compound Name | N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-N'-(5,6,7,8-tetrahydronaphthalen-1-yl)oxamide |
|---|---|
| PubChem CID | 71861885 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-N'-(5,6,7,8-tetrahydronaphthalen-1-yl)oxamide |
| SMILES | O=C(Nc1cccc2c1CCCC2)C(=O)N[C@H]1c2ccccc2C[C@H]1O |
| InChI | InChI=1S/C21H22N2O3/c24-18-12-14-7-2-4-10-16(14)19(18)23-21(26)20(25)22-17-11-5-8-13-6-1-3-9-15(13)17/h2,4-5,7-8,10-11,18-19,24H,1,3,6,9,12H2,(H,22,25)(H,23,26)/t18-,19+/m1/s1 |
| InChIKey | RSOLUNXLCJWXGT-MOPGFXCFSA-N |
| XLogP | 2.28 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|