C23H25ClN4O3 — CID 166232426
N-[2-(4-chlorophenyl)-2-morpholin-4-ylethyl]-N'-(1-methylindol-6-yl)oxamide (PubChem CID 166232426) has the molecular formula C23H25ClN4O3 and a molecular weight of 440.93 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)-2-morpholin-4-ylethyl]-N'-(1-methylindol-6-yl)oxamide.
| Compound Name | N-[2-(4-chlorophenyl)-2-morpholin-4-ylethyl]-N'-(1-methylindol-6-yl)oxamide |
|---|---|
| PubChem CID | 166232426 |
| Molecular Formula | C23H25ClN4O3 |
| Molecular Weight | 440.93 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | N-[2-(4-chlorophenyl)-2-morpholin-4-ylethyl]-N'-(1-methylindol-6-yl)oxamide |
| SMILES | Cn1ccc2ccc(NC(=O)C(=O)NCC(c3ccc(Cl)cc3)N3CCOCC3)cc21 |
| InChI | InChI=1S/C23H25ClN4O3/c1-27-9-8-17-4-7-19(14-20(17)27)26-23(30)22(29)25-15-21(28-10-12-31-13-11-28)16-2-5-18(24)6-3-16/h2-9,14,21H,10-13,15H2,1H3,(H,25,29)(H,26,30) |
| InChIKey | VKKRYHWKGYLVLL-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.93 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|