C20H20Cl2FN3O2 — CID 46199765
N'-(4-chloro-3-fluorophenyl)-N-[2-(4-chlorophenyl)-2-pyrrolidin-1-ylethyl]oxamide (PubChem CID 46199765) has the molecular formula C20H20Cl2FN3O2 and a molecular weight of 424.30 g/mol. Its IUPAC name is N'-(4-chloro-3-fluorophenyl)-N-[2-(4-chlorophenyl)-2-pyrrolidin-1-ylethyl]oxamide.
| Compound Name | N'-(4-chloro-3-fluorophenyl)-N-[2-(4-chlorophenyl)-2-pyrrolidin-1-ylethyl]oxamide |
|---|---|
| PubChem CID | 46199765 |
| Molecular Formula | C20H20Cl2FN3O2 |
| Molecular Weight | 424.30 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | N'-(4-chloro-3-fluorophenyl)-N-[2-(4-chlorophenyl)-2-pyrrolidin-1-ylethyl]oxamide |
| SMILES | O=C(NCC(c1ccc(Cl)cc1)N1CCCC1)C(=O)Nc1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C20H20Cl2FN3O2/c21-14-5-3-13(4-6-14)18(26-9-1-2-10-26)12-24-19(27)20(28)25-15-7-8-16(22)17(23)11-15/h3-8,11,18H,1-2,9-10,12H2,(H,24,27)(H,25,28) |
| InChIKey | AFDBDOJIONZGFY-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.30 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|