C16H25Cl2N3OS — CID 119865579
(2S)-2-amino-4-methylsulfanyl-N-(1-propylindol-5-yl)butanamide;dihydrochloride (PubChem CID 119865579) has the molecular formula C16H25Cl2N3OS and a molecular weight of 378.37 g/mol. Its IUPAC name is (2S)-2-amino-4-methylsulfanyl-N-(1-propylindol-5-yl)butanamide;dihydrochloride.
| Compound Name | (2S)-2-amino-4-methylsulfanyl-N-(1-propylindol-5-yl)butanamide;dihydrochloride |
|---|---|
| PubChem CID | 119865579 |
| Molecular Formula | C16H25Cl2N3OS |
| Molecular Weight | 378.37 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | (2S)-2-amino-4-methylsulfanyl-N-(1-propylindol-5-yl)butanamide;dihydrochloride |
| SMILES | CCCn1ccc2cc(NC(=O)[C@@H](N)CCSC)ccc21.Cl.Cl |
| InChI | InChI=1S/C16H23N3OS.2ClH/c1-3-8-19-9-6-12-11-13(4-5-15(12)19)18-16(20)14(17)7-10-21-2;;/h4-6,9,11,14H,3,7-8,10,17H2,1-2H3,(H,18,20);2*1H/t14-;;/m0../s1 |
| InChIKey | ZJUJHNSDTKZGSE-UTLKBRERSA-N |
| XLogP | 3.91 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.37 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |