C16H22N4O2S — CID 119312283
(2S)-2-amino-N-[1-[2-(methylamino)-2-oxoethyl]indol-6-yl]-4-methylsulfanylbutanamide (PubChem CID 119312283) has the molecular formula C16H22N4O2S and a molecular weight of 334.45 g/mol. Its IUPAC name is (2S)-2-amino-N-[1-[2-(methylamino)-2-oxoethyl]indol-6-yl]-4-methylsulfanylbutanamide.
| Compound Name | (2S)-2-amino-N-[1-[2-(methylamino)-2-oxoethyl]indol-6-yl]-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 119312283 |
| Molecular Formula | C16H22N4O2S |
| Molecular Weight | 334.45 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | (2S)-2-amino-N-[1-[2-(methylamino)-2-oxoethyl]indol-6-yl]-4-methylsulfanylbutanamide |
| SMILES | CNC(=O)Cn1ccc2ccc(NC(=O)[C@@H](N)CCSC)cc21 |
| InChI | InChI=1S/C16H22N4O2S/c1-18-15(21)10-20-7-5-11-3-4-12(9-14(11)20)19-16(22)13(17)6-8-23-2/h3-5,7,9,13H,6,8,10,17H2,1-2H3,(H,18,21)(H,19,22)/t13-/m0/s1 |
| InChIKey | VFPXHIAYLWQZRZ-ZDUSSCGKSA-N |
| XLogP | 1.41 |
| TPSA | 89.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.45 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |