C14H17N3O3S — CID 61148066
(2S)-2-amino-N-(2-methyl-1,3-dioxoisoindol-5-yl)-4-methylsulfanylbutanamide (PubChem CID 61148066) has the molecular formula C14H17N3O3S and a molecular weight of 307.38 g/mol. Its IUPAC name is (2S)-2-amino-N-(2-methyl-1,3-dioxoisoindol-5-yl)-4-methylsulfanylbutanamide.
| Compound Name | (2S)-2-amino-N-(2-methyl-1,3-dioxoisoindol-5-yl)-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 61148066 |
| Molecular Formula | C14H17N3O3S |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | (2S)-2-amino-N-(2-methyl-1,3-dioxoisoindol-5-yl)-4-methylsulfanylbutanamide |
| SMILES | CSCC[C@H](N)C(=O)Nc1ccc2c(c1)C(=O)N(C)C2=O |
| InChI | InChI=1S/C14H17N3O3S/c1-17-13(19)9-4-3-8(7-10(9)14(17)20)16-12(18)11(15)5-6-21-2/h3-4,7,11H,5-6,15H2,1-2H3,(H,16,18)/t11-/m0/s1 |
| InChIKey | KIGLDVNOJCLEQB-NSHDSACASA-N |
| XLogP | 0.93 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|