C25H37N5O2 — CID 56554619
4-(cyclohexylcarbamoylamino)-N-[1-(2-methylpropyl)indol-5-yl]piperidine-1-carboxamide (PubChem CID 56554619) has the molecular formula C25H37N5O2 and a molecular weight of 439.60 g/mol. Its IUPAC name is 4-(cyclohexylcarbamoylamino)-N-[1-(2-methylpropyl)indol-5-yl]piperidine-1-carboxamide.
| Compound Name | 4-(cyclohexylcarbamoylamino)-N-[1-(2-methylpropyl)indol-5-yl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 56554619 |
| Molecular Formula | C25H37N5O2 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.29 |
| IUPAC Name | 4-(cyclohexylcarbamoylamino)-N-[1-(2-methylpropyl)indol-5-yl]piperidine-1-carboxamide |
| SMILES | CC(C)Cn1ccc2cc(NC(=O)N3CCC(NC(=O)NC4CCCCC4)CC3)ccc21 |
| InChI | InChI=1S/C25H37N5O2/c1-18(2)17-30-13-10-19-16-22(8-9-23(19)30)28-25(32)29-14-11-21(12-15-29)27-24(31)26-20-6-4-3-5-7-20/h8-10,13,16,18,20-21H,3-7,11-12,14-15,17H2,1-2H3,(H,28,32)(H2,26,27,31) |
| InChIKey | BCRLRRKOJRMVOF-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 78.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |