C20H30N4O — CID 126767118
1-[(1-methylpiperidin-3-yl)methyl]-3-[1-(2-methylpropyl)indol-5-yl]urea (PubChem CID 126767118) has the molecular formula C20H30N4O and a molecular weight of 342.49 g/mol. Its IUPAC name is 1-[(1-methylpiperidin-3-yl)methyl]-3-[1-(2-methylpropyl)indol-5-yl]urea.
| Compound Name | 1-[(1-methylpiperidin-3-yl)methyl]-3-[1-(2-methylpropyl)indol-5-yl]urea |
|---|---|
| PubChem CID | 126767118 |
| Molecular Formula | C20H30N4O |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.24 |
| IUPAC Name | 1-[(1-methylpiperidin-3-yl)methyl]-3-[1-(2-methylpropyl)indol-5-yl]urea |
| SMILES | CC(C)Cn1ccc2cc(NC(=O)NCC3CCCN(C)C3)ccc21 |
| InChI | InChI=1S/C20H30N4O/c1-15(2)13-24-10-8-17-11-18(6-7-19(17)24)22-20(25)21-12-16-5-4-9-23(3)14-16/h6-8,10-11,15-16H,4-5,9,12-14H2,1-3H3,(H2,21,22,25) |
| InChIKey | MVDGSGPPHFEFFS-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 49.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |