C18H21N3OS — CID 56528070
1-[1-(2-methylpropyl)indol-5-yl]-3-(thiophen-3-ylmethyl)urea (PubChem CID 56528070) has the molecular formula C18H21N3OS and a molecular weight of 327.45 g/mol. Its IUPAC name is 1-[1-(2-methylpropyl)indol-5-yl]-3-(thiophen-3-ylmethyl)urea.
| Compound Name | 1-[1-(2-methylpropyl)indol-5-yl]-3-(thiophen-3-ylmethyl)urea |
|---|---|
| PubChem CID | 56528070 |
| Molecular Formula | C18H21N3OS |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 1-[1-(2-methylpropyl)indol-5-yl]-3-(thiophen-3-ylmethyl)urea |
| SMILES | CC(C)Cn1ccc2cc(NC(=O)NCc3ccsc3)ccc21 |
| InChI | InChI=1S/C18H21N3OS/c1-13(2)11-21-7-5-15-9-16(3-4-17(15)21)20-18(22)19-10-14-6-8-23-12-14/h3-9,12-13H,10-11H2,1-2H3,(H2,19,20,22) |
| InChIKey | PLCOEAHZCVUXOD-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |