C18H24N2O2 — CID 110014325
2-hydroxy-N-[1-(2-methylpropyl)indol-5-yl]cyclopentane-1-carboxamide (PubChem CID 110014325) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is 2-hydroxy-N-[1-(2-methylpropyl)indol-5-yl]cyclopentane-1-carboxamide.
| Compound Name | 2-hydroxy-N-[1-(2-methylpropyl)indol-5-yl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 110014325 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | 2-hydroxy-N-[1-(2-methylpropyl)indol-5-yl]cyclopentane-1-carboxamide |
| SMILES | CC(C)Cn1ccc2cc(NC(=O)C3CCCC3O)ccc21 |
| InChI | InChI=1S/C18H24N2O2/c1-12(2)11-20-9-8-13-10-14(6-7-16(13)20)19-18(22)15-4-3-5-17(15)21/h6-10,12,15,17,21H,3-5,11H2,1-2H3,(H,19,22) |
| InChIKey | XFAZLOSPRXYQCV-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |