C18H25N3O2 — CID 120940198
(2R,3S)-2-methyl-N-[1-(2-methylpropyl)indol-5-yl]morpholine-3-carboxamide (PubChem CID 120940198) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is (2R,3S)-2-methyl-N-[1-(2-methylpropyl)indol-5-yl]morpholine-3-carboxamide.
| Compound Name | (2R,3S)-2-methyl-N-[1-(2-methylpropyl)indol-5-yl]morpholine-3-carboxamide |
|---|---|
| PubChem CID | 120940198 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | (2R,3S)-2-methyl-N-[1-(2-methylpropyl)indol-5-yl]morpholine-3-carboxamide |
| SMILES | CC(C)Cn1ccc2cc(NC(=O)[C@H]3NCCO[C@@H]3C)ccc21 |
| InChI | InChI=1S/C18H25N3O2/c1-12(2)11-21-8-6-14-10-15(4-5-16(14)21)20-18(22)17-13(3)23-9-7-19-17/h4-6,8,10,12-13,17,19H,7,9,11H2,1-3H3,(H,20,22)/t13-,17+/m1/s1 |
| InChIKey | JDDJJGWVWHMAMW-DYVFJYSZSA-N |
| XLogP | 2.61 |
| TPSA | 55.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |