C12H16ClIN2O2 — CID 120917297
(2R,3S)-N-(4-iodophenyl)-2-methylmorpholine-3-carboxamide;hydrochloride (PubChem CID 120917297) has the molecular formula C12H16ClIN2O2 and a molecular weight of 382.63 g/mol. Its IUPAC name is (2R,3S)-N-(4-iodophenyl)-2-methylmorpholine-3-carboxamide;hydrochloride.
| Compound Name | (2R,3S)-N-(4-iodophenyl)-2-methylmorpholine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120917297 |
| Molecular Formula | C12H16ClIN2O2 |
| Molecular Weight | 382.63 g/mol |
| Exact Mass | 381.99 |
| IUPAC Name | (2R,3S)-N-(4-iodophenyl)-2-methylmorpholine-3-carboxamide;hydrochloride |
| SMILES | C[C@H]1OCCN[C@@H]1C(=O)Nc1ccc(I)cc1.Cl |
| InChI | InChI=1S/C12H15IN2O2.ClH/c1-8-11(14-6-7-17-8)12(16)15-10-4-2-9(13)3-5-10;/h2-5,8,11,14H,6-7H2,1H3,(H,15,16);1H/t8-,11+;/m1./s1 |
| InChIKey | CXMGFMDMLACASQ-NINOIYOQSA-N |
| XLogP | 2.03 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.63 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|