C19H22N2O5S — CID 120930531
(2R,3S)-2-methyl-N-[4-(4-methylsulfonylphenoxy)phenyl]morpholine-3-carboxamide (PubChem CID 120930531) has the molecular formula C19H22N2O5S and a molecular weight of 390.46 g/mol. Its IUPAC name is (2R,3S)-2-methyl-N-[4-(4-methylsulfonylphenoxy)phenyl]morpholine-3-carboxamide.
| Compound Name | (2R,3S)-2-methyl-N-[4-(4-methylsulfonylphenoxy)phenyl]morpholine-3-carboxamide |
|---|---|
| PubChem CID | 120930531 |
| Molecular Formula | C19H22N2O5S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | (2R,3S)-2-methyl-N-[4-(4-methylsulfonylphenoxy)phenyl]morpholine-3-carboxamide |
| SMILES | C[C@H]1OCCN[C@@H]1C(=O)Nc1ccc(Oc2ccc(S(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C19H22N2O5S/c1-13-18(20-11-12-25-13)19(22)21-14-3-5-15(6-4-14)26-16-7-9-17(10-8-16)27(2,23)24/h3-10,13,18,20H,11-12H2,1-2H3,(H,21,22)/t13-,18+/m1/s1 |
| InChIKey | CSDNWWNMBJKSAE-ACJLOTCBSA-N |
| XLogP | 2.20 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |