C19H23ClN2O4S — CID 119315410
N-[4-(4-methylsulfonylphenoxy)phenyl]piperidine-2-carboxamide;hydrochloride (PubChem CID 119315410) has the molecular formula C19H23ClN2O4S and a molecular weight of 410.92 g/mol. Its IUPAC name is N-[4-(4-methylsulfonylphenoxy)phenyl]piperidine-2-carboxamide;hydrochloride.
| Compound Name | N-[4-(4-methylsulfonylphenoxy)phenyl]piperidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119315410 |
| Molecular Formula | C19H23ClN2O4S |
| Molecular Weight | 410.92 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | N-[4-(4-methylsulfonylphenoxy)phenyl]piperidine-2-carboxamide;hydrochloride |
| SMILES | CS(=O)(=O)c1ccc(Oc2ccc(NC(=O)C3CCCCN3)cc2)cc1.Cl |
| InChI | InChI=1S/C19H22N2O4S.ClH/c1-26(23,24)17-11-9-16(10-12-17)25-15-7-5-14(6-8-15)21-19(22)18-4-2-3-13-20-18;/h5-12,18,20H,2-4,13H2,1H3,(H,21,22);1H |
| InChIKey | COGQQHYHJDBYFW-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.92 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |