C18H20N2O4S — CID 119331523
N-[4-(3-methylsulfonylphenoxy)phenyl]pyrrolidine-2-carboxamide (PubChem CID 119331523) has the molecular formula C18H20N2O4S and a molecular weight of 360.44 g/mol. Its IUPAC name is N-[4-(3-methylsulfonylphenoxy)phenyl]pyrrolidine-2-carboxamide.
| Compound Name | N-[4-(3-methylsulfonylphenoxy)phenyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 119331523 |
| Molecular Formula | C18H20N2O4S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | N-[4-(3-methylsulfonylphenoxy)phenyl]pyrrolidine-2-carboxamide |
| SMILES | CS(=O)(=O)c1cccc(Oc2ccc(NC(=O)C3CCCN3)cc2)c1 |
| InChI | InChI=1S/C18H20N2O4S/c1-25(22,23)16-5-2-4-15(12-16)24-14-9-7-13(8-10-14)20-18(21)17-6-3-11-19-17/h2,4-5,7-10,12,17,19H,3,6,11H2,1H3,(H,20,21) |
| InChIKey | RJGDRABCHCWIJE-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |