C13H15F3N2O3 — CID 120917325
(2R,3S)-2-methyl-N-[4-(trifluoromethoxy)phenyl]morpholine-3-carboxamide (PubChem CID 120917325) has the molecular formula C13H15F3N2O3 and a molecular weight of 304.27 g/mol. Its IUPAC name is (2R,3S)-2-methyl-N-[4-(trifluoromethoxy)phenyl]morpholine-3-carboxamide.
| Compound Name | (2R,3S)-2-methyl-N-[4-(trifluoromethoxy)phenyl]morpholine-3-carboxamide |
|---|---|
| PubChem CID | 120917325 |
| Molecular Formula | C13H15F3N2O3 |
| Molecular Weight | 304.27 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | (2R,3S)-2-methyl-N-[4-(trifluoromethoxy)phenyl]morpholine-3-carboxamide |
| SMILES | C[C@H]1OCCN[C@@H]1C(=O)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H15F3N2O3/c1-8-11(17-6-7-20-8)12(19)18-9-2-4-10(5-3-9)21-13(14,15)16/h2-5,8,11,17H,6-7H2,1H3,(H,18,19)/t8-,11+/m1/s1 |
| InChIKey | ZFADKWRMCDEABK-KCJUWKMLSA-N |
| XLogP | 1.90 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.27 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |