C25H36N4O2 — CID 56527629
1-[1-(cyclohexanecarbonyl)piperidin-4-yl]-3-[1-(2-methylpropyl)indol-5-yl]urea (PubChem CID 56527629) has the molecular formula C25H36N4O2 and a molecular weight of 424.59 g/mol. Its IUPAC name is 1-[1-(cyclohexanecarbonyl)piperidin-4-yl]-3-[1-(2-methylpropyl)indol-5-yl]urea.
| Compound Name | 1-[1-(cyclohexanecarbonyl)piperidin-4-yl]-3-[1-(2-methylpropyl)indol-5-yl]urea |
|---|---|
| PubChem CID | 56527629 |
| Molecular Formula | C25H36N4O2 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.28 |
| IUPAC Name | 1-[1-(cyclohexanecarbonyl)piperidin-4-yl]-3-[1-(2-methylpropyl)indol-5-yl]urea |
| SMILES | CC(C)Cn1ccc2cc(NC(=O)NC3CCN(C(=O)C4CCCCC4)CC3)ccc21 |
| InChI | InChI=1S/C25H36N4O2/c1-18(2)17-29-13-10-20-16-22(8-9-23(20)29)27-25(31)26-21-11-14-28(15-12-21)24(30)19-6-4-3-5-7-19/h8-10,13,16,18-19,21H,3-7,11-12,14-15,17H2,1-2H3,(H2,26,27,31) |
| InChIKey | FTCGYIBWXAGWGU-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 66.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |