C24H30N4O2 — CID 56527612
4-(4-methoxyphenyl)-N-[1-(2-methylpropyl)indol-5-yl]piperazine-1-carboxamide (PubChem CID 56527612) has the molecular formula C24H30N4O2 and a molecular weight of 406.53 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-N-[1-(2-methylpropyl)indol-5-yl]piperazine-1-carboxamide.
| Compound Name | 4-(4-methoxyphenyl)-N-[1-(2-methylpropyl)indol-5-yl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 56527612 |
| Molecular Formula | C24H30N4O2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | 4-(4-methoxyphenyl)-N-[1-(2-methylpropyl)indol-5-yl]piperazine-1-carboxamide |
| SMILES | COc1ccc(N2CCN(C(=O)Nc3ccc4c(ccn4CC(C)C)c3)CC2)cc1 |
| InChI | InChI=1S/C24H30N4O2/c1-18(2)17-28-11-10-19-16-20(4-9-23(19)28)25-24(29)27-14-12-26(13-15-27)21-5-7-22(30-3)8-6-21/h4-11,16,18H,12-15,17H2,1-3H3,(H,25,29) |
| InChIKey | ASPSDVVCIPKAPU-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 49.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|