C23H25N3O4S — CID 55740991
ethyl 5-[[4-(4-methoxyphenyl)piperazine-1-carbonyl]amino]-1-benzothiophene-2-carboxylate (PubChem CID 55740991) has the molecular formula C23H25N3O4S and a molecular weight of 439.54 g/mol. Its IUPAC name is ethyl 5-[[4-(4-methoxyphenyl)piperazine-1-carbonyl]amino]-1-benzothiophene-2-carboxylate.
| Compound Name | ethyl 5-[[4-(4-methoxyphenyl)piperazine-1-carbonyl]amino]-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 55740991 |
| Molecular Formula | C23H25N3O4S |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | ethyl 5-[[4-(4-methoxyphenyl)piperazine-1-carbonyl]amino]-1-benzothiophene-2-carboxylate |
| SMILES | CCOC(=O)c1cc2cc(NC(=O)N3CCN(c4ccc(OC)cc4)CC3)ccc2s1 |
| InChI | InChI=1S/C23H25N3O4S/c1-3-30-22(27)21-15-16-14-17(4-9-20(16)31-21)24-23(28)26-12-10-25(11-13-26)18-5-7-19(29-2)8-6-18/h4-9,14-15H,3,10-13H2,1-2H3,(H,24,28) |
| InChIKey | YBSMHSQNKXZOMI-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|