C22H28N3O5+ — CID 7084952
diethyl 4-[4-(4-methoxyphenyl)piperazin-1-yl]pyridin-1-ium-2,6-dicarboxylate (PubChem CID 7084952) has the molecular formula C22H28N3O5+ and a molecular weight of 414.48 g/mol. Its IUPAC name is diethyl 4-[4-(4-methoxyphenyl)piperazin-1-yl]pyridin-1-ium-2,6-dicarboxylate.
| Compound Name | diethyl 4-[4-(4-methoxyphenyl)piperazin-1-yl]pyridin-1-ium-2,6-dicarboxylate |
|---|---|
| PubChem CID | 7084952 |
| Molecular Formula | C22H28N3O5+ |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | diethyl 4-[4-(4-methoxyphenyl)piperazin-1-yl]pyridin-1-ium-2,6-dicarboxylate |
| SMILES | CCOC(=O)c1cc(N2CCN(c3ccc(OC)cc3)CC2)cc(C(=O)OCC)[nH+]1 |
| InChI | InChI=1S/C22H27N3O5/c1-4-29-21(26)19-14-17(15-20(23-19)22(27)30-5-2)25-12-10-24(11-13-25)16-6-8-18(28-3)9-7-16/h6-9,14-15H,4-5,10-13H2,1-3H3/p+1 |
| InChIKey | WEVMEWOLWGVCDY-UHFFFAOYSA-O |
| XLogP | 2.19 |
| TPSA | 82.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|