C22H22ClN3O3S — CID 52626615
ethyl 5-[[4-(3-chlorophenyl)piperazine-1-carbonyl]amino]-1-benzothiophene-2-carboxylate (PubChem CID 52626615) has the molecular formula C22H22ClN3O3S and a molecular weight of 443.96 g/mol. Its IUPAC name is ethyl 5-[[4-(3-chlorophenyl)piperazine-1-carbonyl]amino]-1-benzothiophene-2-carboxylate.
| Compound Name | ethyl 5-[[4-(3-chlorophenyl)piperazine-1-carbonyl]amino]-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 52626615 |
| Molecular Formula | C22H22ClN3O3S |
| Molecular Weight | 443.96 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | ethyl 5-[[4-(3-chlorophenyl)piperazine-1-carbonyl]amino]-1-benzothiophene-2-carboxylate |
| SMILES | CCOC(=O)c1cc2cc(NC(=O)N3CCN(c4cccc(Cl)c4)CC3)ccc2s1 |
| InChI | InChI=1S/C22H22ClN3O3S/c1-2-29-21(27)20-13-15-12-17(6-7-19(15)30-20)24-22(28)26-10-8-25(9-11-26)18-5-3-4-16(23)14-18/h3-7,12-14H,2,8-11H2,1H3,(H,24,28) |
| InChIKey | WQIYABBDIRZLFH-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.96 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |