C21H21N3O3S — CID 47040792
ethyl 5-[(2-pyridin-4-ylpyrrolidine-1-carbonyl)amino]-1-benzothiophene-2-carboxylate (PubChem CID 47040792) has the molecular formula C21H21N3O3S and a molecular weight of 395.48 g/mol. Its IUPAC name is ethyl 5-[(2-pyridin-4-ylpyrrolidine-1-carbonyl)amino]-1-benzothiophene-2-carboxylate.
| Compound Name | ethyl 5-[(2-pyridin-4-ylpyrrolidine-1-carbonyl)amino]-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 47040792 |
| Molecular Formula | C21H21N3O3S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | ethyl 5-[(2-pyridin-4-ylpyrrolidine-1-carbonyl)amino]-1-benzothiophene-2-carboxylate |
| SMILES | CCOC(=O)c1cc2cc(NC(=O)N3CCCC3c3ccncc3)ccc2s1 |
| InChI | InChI=1S/C21H21N3O3S/c1-2-27-20(25)19-13-15-12-16(5-6-18(15)28-19)23-21(26)24-11-3-4-17(24)14-7-9-22-10-8-14/h5-10,12-13,17H,2-4,11H2,1H3,(H,23,26) |
| InChIKey | MNCDKPVGLPTFNZ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |