C20H25N3O — CID 124731980
(2R)-N-(2,5-diethylphenyl)-2-pyridin-4-ylpyrrolidine-1-carboxamide (PubChem CID 124731980) has the molecular formula C20H25N3O and a molecular weight of 323.44 g/mol. Its IUPAC name is (2R)-N-(2,5-diethylphenyl)-2-pyridin-4-ylpyrrolidine-1-carboxamide.
| Compound Name | (2R)-N-(2,5-diethylphenyl)-2-pyridin-4-ylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 124731980 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | (2R)-N-(2,5-diethylphenyl)-2-pyridin-4-ylpyrrolidine-1-carboxamide |
| SMILES | CCc1ccc(CC)c(NC(=O)N2CCC[C@@H]2c2ccncc2)c1 |
| InChI | InChI=1S/C20H25N3O/c1-3-15-7-8-16(4-2)18(14-15)22-20(24)23-13-5-6-19(23)17-9-11-21-12-10-17/h7-12,14,19H,3-6,13H2,1-2H3,(H,22,24)/t19-/m1/s1 |
| InChIKey | JGVYDCYQAZUGGB-LJQANCHMSA-N |
| XLogP | 4.58 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |