C18H18FN3O3 — CID 86994028
methyl 4-fluoro-3-[(2-pyridin-4-ylpyrrolidine-1-carbonyl)amino]benzoate (PubChem CID 86994028) has the molecular formula C18H18FN3O3 and a molecular weight of 343.36 g/mol. Its IUPAC name is methyl 4-fluoro-3-[(2-pyridin-4-ylpyrrolidine-1-carbonyl)amino]benzoate.
| Compound Name | methyl 4-fluoro-3-[(2-pyridin-4-ylpyrrolidine-1-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 86994028 |
| Molecular Formula | C18H18FN3O3 |
| Molecular Weight | 343.36 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | methyl 4-fluoro-3-[(2-pyridin-4-ylpyrrolidine-1-carbonyl)amino]benzoate |
| SMILES | COC(=O)c1ccc(F)c(NC(=O)N2CCCC2c2ccncc2)c1 |
| InChI | InChI=1S/C18H18FN3O3/c1-25-17(23)13-4-5-14(19)15(11-13)21-18(24)22-10-2-3-16(22)12-6-8-20-9-7-12/h4-9,11,16H,2-3,10H2,1H3,(H,21,24) |
| InChIKey | ACVKCKGUFVAOFO-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.36 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |