C18H22N4O3S — CID 166209944
N-(2,3-dimethyl-5-sulfamoylphenyl)-2-pyridin-4-ylpyrrolidine-1-carboxamide (PubChem CID 166209944) has the molecular formula C18H22N4O3S and a molecular weight of 374.47 g/mol. Its IUPAC name is N-(2,3-dimethyl-5-sulfamoylphenyl)-2-pyridin-4-ylpyrrolidine-1-carboxamide.
| Compound Name | N-(2,3-dimethyl-5-sulfamoylphenyl)-2-pyridin-4-ylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 166209944 |
| Molecular Formula | C18H22N4O3S |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | N-(2,3-dimethyl-5-sulfamoylphenyl)-2-pyridin-4-ylpyrrolidine-1-carboxamide |
| SMILES | Cc1cc(S(N)(=O)=O)cc(NC(=O)N2CCCC2c2ccncc2)c1C |
| InChI | InChI=1S/C18H22N4O3S/c1-12-10-15(26(19,24)25)11-16(13(12)2)21-18(23)22-9-3-4-17(22)14-5-7-20-8-6-14/h5-8,10-11,17H,3-4,9H2,1-2H3,(H,21,23)(H2,19,24,25) |
| InChIKey | WXHOANOBJUEOAV-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |