C12H14N4O3S — CID 81258188
N-(2,3-dimethyl-5-sulfamoylphenyl)imidazole-1-carboxamide (PubChem CID 81258188) has the molecular formula C12H14N4O3S and a molecular weight of 294.34 g/mol. Its IUPAC name is N-(2,3-dimethyl-5-sulfamoylphenyl)imidazole-1-carboxamide.
| Compound Name | N-(2,3-dimethyl-5-sulfamoylphenyl)imidazole-1-carboxamide |
|---|---|
| PubChem CID | 81258188 |
| Molecular Formula | C12H14N4O3S |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | N-(2,3-dimethyl-5-sulfamoylphenyl)imidazole-1-carboxamide |
| SMILES | Cc1cc(S(N)(=O)=O)cc(NC(=O)n2ccnc2)c1C |
| InChI | InChI=1S/C12H14N4O3S/c1-8-5-10(20(13,18)19)6-11(9(8)2)15-12(17)16-4-3-14-7-16/h3-7H,1-2H3,(H,15,17)(H2,13,18,19) |
| InChIKey | SMONIRFCZHMMDZ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |