C17H17FN4O2 — CID 94336529
(2S)-N'-(4-fluorobenzoyl)-2-pyridin-4-ylpyrrolidine-1-carbohydrazide (PubChem CID 94336529) has the molecular formula C17H17FN4O2 and a molecular weight of 328.35 g/mol. Its IUPAC name is (2S)-N'-(4-fluorobenzoyl)-2-pyridin-4-ylpyrrolidine-1-carbohydrazide.
| Compound Name | (2S)-N'-(4-fluorobenzoyl)-2-pyridin-4-ylpyrrolidine-1-carbohydrazide |
|---|---|
| PubChem CID | 94336529 |
| Molecular Formula | C17H17FN4O2 |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | (2S)-N'-(4-fluorobenzoyl)-2-pyridin-4-ylpyrrolidine-1-carbohydrazide |
| SMILES | O=C(NNC(=O)N1CCC[C@H]1c1ccncc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H17FN4O2/c18-14-5-3-13(4-6-14)16(23)20-21-17(24)22-11-1-2-15(22)12-7-9-19-10-8-12/h3-10,15H,1-2,11H2,(H,20,23)(H,21,24)/t15-/m0/s1 |
| InChIKey | LPQOLFYQXOKXQD-HNNXBMFYSA-N |
| XLogP | 2.41 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|