C16H14BrFN2O — CID 60727625
(2-bromo-5-fluorophenyl)-(2-pyridin-4-ylpyrrolidin-1-yl)methanone (PubChem CID 60727625) has the molecular formula C16H14BrFN2O and a molecular weight of 349.20 g/mol. Its IUPAC name is (2-bromo-5-fluorophenyl)-(2-pyridin-4-ylpyrrolidin-1-yl)methanone.
| Compound Name | (2-bromo-5-fluorophenyl)-(2-pyridin-4-ylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 60727625 |
| Molecular Formula | C16H14BrFN2O |
| Molecular Weight | 349.20 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | (2-bromo-5-fluorophenyl)-(2-pyridin-4-ylpyrrolidin-1-yl)methanone |
| SMILES | O=C(c1cc(F)ccc1Br)N1CCCC1c1ccncc1 |
| InChI | InChI=1S/C16H14BrFN2O/c17-14-4-3-12(18)10-13(14)16(21)20-9-1-2-15(20)11-5-7-19-8-6-11/h3-8,10,15H,1-2,9H2 |
| InChIKey | HGIQDKHOCCVFSA-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.20 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |