C21H21N3O — CID 929734
(2R)-N-naphthalen-1-yl-2-pyridin-4-ylpiperidine-1-carboxamide (PubChem CID 929734) has the molecular formula C21H21N3O and a molecular weight of 331.42 g/mol. Its IUPAC name is (2R)-N-naphthalen-1-yl-2-pyridin-4-ylpiperidine-1-carboxamide.
| Compound Name | (2R)-N-naphthalen-1-yl-2-pyridin-4-ylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 929734 |
| Molecular Formula | C21H21N3O |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | (2R)-N-naphthalen-1-yl-2-pyridin-4-ylpiperidine-1-carboxamide |
| SMILES | O=C(Nc1cccc2ccccc12)N1CCCC[C@@H]1c1ccncc1 |
| InChI | InChI=1S/C21H21N3O/c25-21(23-19-9-5-7-16-6-1-2-8-18(16)19)24-15-4-3-10-20(24)17-11-13-22-14-12-17/h1-2,5-9,11-14,20H,3-4,10,15H2,(H,23,25)/t20-/m1/s1 |
| InChIKey | OTNPKGYHPMECIM-HXUWFJFHSA-N |
| XLogP | 4.99 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |