C20H18ClN3O — CID 47049591
2-(3-chlorophenyl)-N-isoquinolin-5-ylpyrrolidine-1-carboxamide (PubChem CID 47049591) has the molecular formula C20H18ClN3O and a molecular weight of 351.84 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-N-isoquinolin-5-ylpyrrolidine-1-carboxamide.
| Compound Name | 2-(3-chlorophenyl)-N-isoquinolin-5-ylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 47049591 |
| Molecular Formula | C20H18ClN3O |
| Molecular Weight | 351.84 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | 2-(3-chlorophenyl)-N-isoquinolin-5-ylpyrrolidine-1-carboxamide |
| SMILES | O=C(Nc1cccc2cnccc12)N1CCCC1c1cccc(Cl)c1 |
| InChI | InChI=1S/C20H18ClN3O/c21-16-6-1-4-14(12-16)19-8-3-11-24(19)20(25)23-18-7-2-5-15-13-22-10-9-17(15)18/h1-2,4-7,9-10,12-13,19H,3,8,11H2,(H,23,25) |
| InChIKey | HWXUMTCMVHPGQT-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.84 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |