C16H16ClN3O — CID 166212254
1-[2-(3-chlorophenyl)pyrrolidin-1-yl]-2-pyrimidin-5-ylethanone (PubChem CID 166212254) has the molecular formula C16H16ClN3O and a molecular weight of 301.78 g/mol. Its IUPAC name is 1-[2-(3-chlorophenyl)pyrrolidin-1-yl]-2-pyrimidin-5-ylethanone.
| Compound Name | 1-[2-(3-chlorophenyl)pyrrolidin-1-yl]-2-pyrimidin-5-ylethanone |
|---|---|
| PubChem CID | 166212254 |
| Molecular Formula | C16H16ClN3O |
| Molecular Weight | 301.78 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 1-[2-(3-chlorophenyl)pyrrolidin-1-yl]-2-pyrimidin-5-ylethanone |
| SMILES | O=C(Cc1cncnc1)N1CCCC1c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H16ClN3O/c17-14-4-1-3-13(8-14)15-5-2-6-20(15)16(21)7-12-9-18-11-19-10-12/h1,3-4,8-11,15H,2,5-7H2 |
| InChIKey | IJEZNPPTGRTRPD-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.78 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |