C16H21ClN2O2 — CID 102611255
1-[2-(3-chlorophenyl)pyrrolidin-1-yl]-2-(3-methylazetidin-3-yl)oxyethanone (PubChem CID 102611255) has the molecular formula C16H21ClN2O2 and a molecular weight of 308.81 g/mol. Its IUPAC name is 1-[2-(3-chlorophenyl)pyrrolidin-1-yl]-2-(3-methylazetidin-3-yl)oxyethanone.
| Compound Name | 1-[2-(3-chlorophenyl)pyrrolidin-1-yl]-2-(3-methylazetidin-3-yl)oxyethanone |
|---|---|
| PubChem CID | 102611255 |
| Molecular Formula | C16H21ClN2O2 |
| Molecular Weight | 308.81 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 1-[2-(3-chlorophenyl)pyrrolidin-1-yl]-2-(3-methylazetidin-3-yl)oxyethanone |
| SMILES | CC1(OCC(=O)N2CCCC2c2cccc(Cl)c2)CNC1 |
| InChI | InChI=1S/C16H21ClN2O2/c1-16(10-18-11-16)21-9-15(20)19-7-3-6-14(19)12-4-2-5-13(17)8-12/h2,4-5,8,14,18H,3,6-7,9-11H2,1H3 |
| InChIKey | IERPDJNNVBGYON-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.81 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |