C16H22Cl2N2OS — CID 119936713
1-[2-(3-chlorophenyl)pyrrolidin-1-yl]-2-thiomorpholin-3-ylethanone;hydrochloride (PubChem CID 119936713) has the molecular formula C16H22Cl2N2OS and a molecular weight of 361.34 g/mol. Its IUPAC name is 1-[2-(3-chlorophenyl)pyrrolidin-1-yl]-2-thiomorpholin-3-ylethanone;hydrochloride.
| Compound Name | 1-[2-(3-chlorophenyl)pyrrolidin-1-yl]-2-thiomorpholin-3-ylethanone;hydrochloride |
|---|---|
| PubChem CID | 119936713 |
| Molecular Formula | C16H22Cl2N2OS |
| Molecular Weight | 361.34 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 1-[2-(3-chlorophenyl)pyrrolidin-1-yl]-2-thiomorpholin-3-ylethanone;hydrochloride |
| SMILES | Cl.O=C(CC1CSCCN1)N1CCCC1c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H21ClN2OS.ClH/c17-13-4-1-3-12(9-13)15-5-2-7-19(15)16(20)10-14-11-21-8-6-18-14;/h1,3-4,9,14-15,18H,2,5-8,10-11H2;1H |
| InChIKey | XBCQWAPIFZRTMB-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.34 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |