C17H23FN2OS — CID 119940114
1-[2-(4-fluorophenyl)piperidin-1-yl]-2-thiomorpholin-3-ylethanone (PubChem CID 119940114) has the molecular formula C17H23FN2OS and a molecular weight of 322.45 g/mol. Its IUPAC name is 1-[2-(4-fluorophenyl)piperidin-1-yl]-2-thiomorpholin-3-ylethanone.
| Compound Name | 1-[2-(4-fluorophenyl)piperidin-1-yl]-2-thiomorpholin-3-ylethanone |
|---|---|
| PubChem CID | 119940114 |
| Molecular Formula | C17H23FN2OS |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 1-[2-(4-fluorophenyl)piperidin-1-yl]-2-thiomorpholin-3-ylethanone |
| SMILES | O=C(CC1CSCCN1)N1CCCCC1c1ccc(F)cc1 |
| InChI | InChI=1S/C17H23FN2OS/c18-14-6-4-13(5-7-14)16-3-1-2-9-20(16)17(21)11-15-12-22-10-8-19-15/h4-7,15-16,19H,1-3,8-12H2 |
| InChIKey | IORATVVSKOGUBW-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |