C17H24ClN3O2S — CID 119937231
7-phenyl-1-(2-thiomorpholin-3-ylacetyl)-1,4-diazepan-5-one;hydrochloride (PubChem CID 119937231) has the molecular formula C17H24ClN3O2S and a molecular weight of 369.92 g/mol. Its IUPAC name is 7-phenyl-1-(2-thiomorpholin-3-ylacetyl)-1,4-diazepan-5-one;hydrochloride.
| Compound Name | 7-phenyl-1-(2-thiomorpholin-3-ylacetyl)-1,4-diazepan-5-one;hydrochloride |
|---|---|
| PubChem CID | 119937231 |
| Molecular Formula | C17H24ClN3O2S |
| Molecular Weight | 369.92 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | 7-phenyl-1-(2-thiomorpholin-3-ylacetyl)-1,4-diazepan-5-one;hydrochloride |
| SMILES | Cl.O=C1CC(c2ccccc2)N(C(=O)CC2CSCCN2)CCN1 |
| InChI | InChI=1S/C17H23N3O2S.ClH/c21-16-11-15(13-4-2-1-3-5-13)20(8-6-19-16)17(22)10-14-12-23-9-7-18-14;/h1-5,14-15,18H,6-12H2,(H,19,21);1H |
| InChIKey | IVXHCGCNKZXYGC-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.92 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |