C14H20ClN3O2S2 — CID 119939774
4-(2-thiomorpholin-3-ylacetyl)-3-thiophen-2-ylpiperazin-2-one;hydrochloride (PubChem CID 119939774) has the molecular formula C14H20ClN3O2S2 and a molecular weight of 361.92 g/mol. Its IUPAC name is 4-(2-thiomorpholin-3-ylacetyl)-3-thiophen-2-ylpiperazin-2-one;hydrochloride.
| Compound Name | 4-(2-thiomorpholin-3-ylacetyl)-3-thiophen-2-ylpiperazin-2-one;hydrochloride |
|---|---|
| PubChem CID | 119939774 |
| Molecular Formula | C14H20ClN3O2S2 |
| Molecular Weight | 361.92 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | 4-(2-thiomorpholin-3-ylacetyl)-3-thiophen-2-ylpiperazin-2-one;hydrochloride |
| SMILES | Cl.O=C1NCCN(C(=O)CC2CSCCN2)C1c1cccs1 |
| InChI | InChI=1S/C14H19N3O2S2.ClH/c18-12(8-10-9-20-7-4-15-10)17-5-3-16-14(19)13(17)11-2-1-6-21-11;/h1-2,6,10,13,15H,3-5,7-9H2,(H,16,19);1H |
| InChIKey | GQEFSFCIKZIMAL-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.92 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |