C9H11N3O2S — CID 3070020
3-oxo-2-thiophen-2-ylpiperazine-1-carboxamide (PubChem CID 3070020) has the molecular formula C9H11N3O2S and a molecular weight of 225.27 g/mol. Its IUPAC name is 3-oxo-2-thiophen-2-ylpiperazine-1-carboxamide.
| Compound Name | 3-oxo-2-thiophen-2-ylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 3070020 |
| Molecular Formula | C9H11N3O2S |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | 3-oxo-2-thiophen-2-ylpiperazine-1-carboxamide |
| SMILES | NC(=O)N1CCNC(=O)C1c1cccs1 |
| InChI | InChI=1S/C9H11N3O2S/c10-9(14)12-4-3-11-8(13)7(12)6-2-1-5-15-6/h1-2,5,7H,3-4H2,(H2,10,14)(H,11,13) |
| InChIKey | MVXKTRMFTSSHDX-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |