C13H20ClN3O2S — CID 119801478
4-[4-(methylamino)butanoyl]-3-thiophen-2-ylpiperazin-2-one;hydrochloride (PubChem CID 119801478) has the molecular formula C13H20ClN3O2S and a molecular weight of 317.84 g/mol. Its IUPAC name is 4-[4-(methylamino)butanoyl]-3-thiophen-2-ylpiperazin-2-one;hydrochloride.
| Compound Name | 4-[4-(methylamino)butanoyl]-3-thiophen-2-ylpiperazin-2-one;hydrochloride |
|---|---|
| PubChem CID | 119801478 |
| Molecular Formula | C13H20ClN3O2S |
| Molecular Weight | 317.84 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | 4-[4-(methylamino)butanoyl]-3-thiophen-2-ylpiperazin-2-one;hydrochloride |
| SMILES | CNCCCC(=O)N1CCNC(=O)C1c1cccs1.Cl |
| InChI | InChI=1S/C13H19N3O2S.ClH/c1-14-6-2-5-11(17)16-8-7-15-13(18)12(16)10-4-3-9-19-10;/h3-4,9,12,14H,2,5-8H2,1H3,(H,15,18);1H |
| InChIKey | SZMXORMBMVQEAM-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.84 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|