C16H18ClN3O2S — CID 119333806
4-[4-(aminomethyl)benzoyl]-3-thiophen-2-ylpiperazin-2-one;hydrochloride (PubChem CID 119333806) has the molecular formula C16H18ClN3O2S and a molecular weight of 351.86 g/mol. Its IUPAC name is 4-[4-(aminomethyl)benzoyl]-3-thiophen-2-ylpiperazin-2-one;hydrochloride.
| Compound Name | 4-[4-(aminomethyl)benzoyl]-3-thiophen-2-ylpiperazin-2-one;hydrochloride |
|---|---|
| PubChem CID | 119333806 |
| Molecular Formula | C16H18ClN3O2S |
| Molecular Weight | 351.86 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 4-[4-(aminomethyl)benzoyl]-3-thiophen-2-ylpiperazin-2-one;hydrochloride |
| SMILES | Cl.NCc1ccc(C(=O)N2CCNC(=O)C2c2cccs2)cc1 |
| InChI | InChI=1S/C16H17N3O2S.ClH/c17-10-11-3-5-12(6-4-11)16(21)19-8-7-18-15(20)14(19)13-2-1-9-22-13;/h1-6,9,14H,7-8,10,17H2,(H,18,20);1H |
| InChIKey | BHPSJFDJIBIEFW-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.86 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |