C15H22ClN3O2S — CID 119801482
4-(3-aminocyclohexanecarbonyl)-3-thiophen-2-ylpiperazin-2-one;hydrochloride (PubChem CID 119801482) has the molecular formula C15H22ClN3O2S and a molecular weight of 343.88 g/mol. Its IUPAC name is 4-(3-aminocyclohexanecarbonyl)-3-thiophen-2-ylpiperazin-2-one;hydrochloride.
| Compound Name | 4-(3-aminocyclohexanecarbonyl)-3-thiophen-2-ylpiperazin-2-one;hydrochloride |
|---|---|
| PubChem CID | 119801482 |
| Molecular Formula | C15H22ClN3O2S |
| Molecular Weight | 343.88 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 4-(3-aminocyclohexanecarbonyl)-3-thiophen-2-ylpiperazin-2-one;hydrochloride |
| SMILES | Cl.NC1CCCC(C(=O)N2CCNC(=O)C2c2cccs2)C1 |
| InChI | InChI=1S/C15H21N3O2S.ClH/c16-11-4-1-3-10(9-11)15(20)18-7-6-17-14(19)13(18)12-5-2-8-21-12;/h2,5,8,10-11,13H,1,3-4,6-7,9,16H2,(H,17,19);1H |
| InChIKey | MOOUBDYCEHJNLZ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.88 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |