About (3R)-4-[2-[(1S,2R)-2-phenylcyclopropyl]acetyl]-3-thiophen-2-ylpiperazin-2-one
(3R)-4-[2-[(1S,2R)-2-phenylcyclopropyl]acetyl]-3-thiophen-2-ylpiperazin-2-one (PubChem CID 100641562) has the molecular formula C19H20N2O2S
and a molecular weight of 340.45 g/mol. Its IUPAC name is (3R)-4-[2-[(1S,2R)-2-phenylcyclopropyl]acetyl]-3-thiophen-2-ylpiperazin-2-one.
Molecular Properties
| Compound Name | (3R)-4-[2-[(1S,2R)-2-phenylcyclopropyl]acetyl]-3-thiophen-2-ylpiperazin-2-one |
| PubChem CID | 100641562 |
| Molecular Formula | C19H20N2O2S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | (3R)-4-[2-[(1S,2R)-2-phenylcyclopropyl]acetyl]-3-thiophen-2-ylpiperazin-2-one |
| SMILES | O=C1NCCN(C(=O)C[C@@H]2C[C@H]2c2ccccc2)[C@H]1c1cccs1 |
| InChI | InChI=1S/C19H20N2O2S/c22-17(12-14-11-15(14)13-5-2-1-3-6-13)21-9-8-20-19(23)18(21)16-7-4-10-24-16/h1-7,10,14-15,18H,8-9,11-12H2,(H,20,23)/t14-,15-,18-/m0/s1 |
| InChIKey | QMTNEJKAJMPYED-MPGHIAIKSA-N |
| XLogP | 2.94 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3R)-4-[2-[(1S,2R)-2-phenylcyclopropyl]acetyl]-3-thiophen-2-ylpiperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-4-[2-[(1S,2R)-2-phenylcyclopropyl]acetyl]-3-thiophen-2-ylpiperazin-2-one?
The IUPAC name of (3R)-4-[2-[(1S,2R)-2-phenylcyclopropyl]acetyl]-3-thiophen-2-ylpiperazin-2-one (CID 100641562) is (3R)-4-[2-[(1S,2R)-2-phenylcyclopropyl]acetyl]-3-thiophen-2-ylpiperazin-2-one.
What is the SMILES notation for (3R)-4-[2-[(1S,2R)-2-phenylcyclopropyl]acetyl]-3-thiophen-2-ylpiperazin-2-one?
The canonical SMILES for (3R)-4-[2-[(1S,2R)-2-phenylcyclopropyl]acetyl]-3-thiophen-2-ylpiperazin-2-one is O=C1NCCN(C(=O)C[C@@H]2C[C@H]2c2ccccc2)[C@H]1c1cccs1.
What is the InChIKey of (3R)-4-[2-[(1S,2R)-2-phenylcyclopropyl]acetyl]-3-thiophen-2-ylpiperazin-2-one?
The InChIKey is QMTNEJKAJMPYED-MPGHIAIKSA-N. The full InChI is InChI=1S/C19H20N2O2S/c22-17(12-14-11-15(14)13-5-2-1-3-6-13)21-9-8-20-19(23)18(21)16-7-4-10-24-16/h1-7,10,14-15,18H,8-9,11-12H2,(H,20,23)/t14-,15-,18-/m0/s1.
What are the key properties of (3R)-4-[2-[(1S,2R)-2-phenylcyclopropyl]acetyl]-3-thiophen-2-ylpiperazin-2-one?
(3R)-4-[2-[(1S,2R)-2-phenylcyclopropyl]acetyl]-3-thiophen-2-ylpiperazin-2-one has a molecular weight of 340.45 g/mol, XLogP of 2.94, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-4-[2-[(1S,2R)-2-phenylcyclopropyl]acetyl]-3-thiophen-2-ylpiperazin-2-one is sourced from PubChem (CID 100641562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).