C21H30N2O2 — CID 110200135
5-(2-cyclopentylacetyl)-4-phenyl-1,5-diazecan-2-one (PubChem CID 110200135) has the molecular formula C21H30N2O2 and a molecular weight of 342.48 g/mol. Its IUPAC name is 5-(2-cyclopentylacetyl)-4-phenyl-1,5-diazecan-2-one.
| Compound Name | 5-(2-cyclopentylacetyl)-4-phenyl-1,5-diazecan-2-one |
|---|---|
| PubChem CID | 110200135 |
| Molecular Formula | C21H30N2O2 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | 5-(2-cyclopentylacetyl)-4-phenyl-1,5-diazecan-2-one |
| SMILES | O=C1CC(c2ccccc2)N(C(=O)CC2CCCC2)CCCCCN1 |
| InChI | InChI=1S/C21H30N2O2/c24-20-16-19(18-11-3-1-4-12-18)23(14-8-2-7-13-22-20)21(25)15-17-9-5-6-10-17/h1,3-4,11-12,17,19H,2,5-10,13-16H2,(H,22,24) |
| InChIKey | HJFOPTCTEVZYTR-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |